C23H26N6O4 — CID 73131095
N-[6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide (PubChem CID 73131095) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide.
| Compound Name | N-[6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 73131095 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-[6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2COC3C2OCC3n2nnnc2-c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H26N6O4/c1-28(2)16-8-4-14(5-9-16)22-25-26-27-29(22)19-13-33-20-18(12-32-21(19)20)24-23(30)15-6-10-17(31-3)11-7-15/h4-11,18-21H,12-13H2,1-3H3,(H,24,30) |
| InChIKey | MIIPQNTXXJAAGI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |