C24H32N6O5 — CID 162801206
2-[1-[2-[[(3S,3aS,6R,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 162801206) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2-[1-[2-[[(3S,3aS,6R,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-[[(3S,3aS,6R,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 162801206 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[1-[2-[[(3S,3aS,6R,6aR)-6-[5-[4-(dimethylamino)phenyl]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | CN(C)c1ccc(-c2nnnn2[C@@H]2CO[C@@H]3[C@@H]2OC[C@@H]3NC(=O)CC2(CC(=O)O)CCCC2)cc1 |
| InChI | InChI=1S/C24H32N6O5/c1-29(2)16-7-5-15(6-8-16)23-26-27-28-30(23)18-14-35-21-17(13-34-22(18)21)25-19(31)11-24(12-20(32)33)9-3-4-10-24/h5-8,17-18,21-22H,3-4,9-14H2,1-2H3,(H,25,31)(H,32,33)/t17-,18+,21-,22+/m0/s1 |
| InChIKey | HMOIGDYYBFPWMS-GKJHBJHPSA-N |
| XLogP | 1.65 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |