C21H18N5O5- — CID 11886286
2-[[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate (PubChem CID 11886286) has the molecular formula C21H18N5O5- and a molecular weight of 420.41 g/mol. Its IUPAC name is 2-[[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate.
| Compound Name | 2-[[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 11886286 |
| Molecular Formula | C21H18N5O5- |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-[[(3S,3aR,6S,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C21H19N5O5/c27-20(13-8-4-5-9-14(13)21(28)29)22-15-10-30-18-16(11-31-17(15)18)26-19(23-24-25-26)12-6-2-1-3-7-12/h1-9,15-18H,10-11H2,(H,22,27)(H,28,29)/p-1/t15-,16-,17+,18+/m0/s1 |
| InChIKey | LMHZBGDFUNQZMW-WNRNVDISSA-M |
| XLogP | -0.16 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |