C24H22N6O3 — CID 162804195
1-[(3S,3aS,6R,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylurea (PubChem CID 162804195) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-[(3S,3aS,6R,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[(3S,3aS,6R,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 162804195 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-[(3S,3aS,6R,6aR)-6-(5-phenyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylurea |
| SMILES | O=C(Nc1cccc2ccccc12)N[C@H]1CO[C@H]2[C@H]1OC[C@H]2n1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C24H22N6O3/c31-24(25-18-12-6-10-15-7-4-5-11-17(15)18)26-19-13-32-22-20(14-33-21(19)22)30-23(27-28-29-30)16-8-2-1-3-9-16/h1-12,19-22H,13-14H2,(H2,25,26,31)/t19-,20+,21-,22+/m0/s1 |
| InChIKey | QLIZUEMFFFNTGY-LNRXMEIDSA-N |
| XLogP | 3.02 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |