C22H21F3N6O4 — CID 73135082
1-[6-[5-(3-methoxyphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 73135082) has the molecular formula C22H21F3N6O4 and a molecular weight of 490.44 g/mol. Its IUPAC name is 1-[6-[5-(3-methoxyphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[6-[5-(3-methoxyphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 73135082 |
| Molecular Formula | C22H21F3N6O4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1-[6-[5-(3-methoxyphenyl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cccc(-c2nnnn2C2COC3C(NC(=O)Nc4cccc(C(F)(F)F)c4)COC32)c1 |
| InChI | InChI=1S/C22H21F3N6O4/c1-33-15-7-2-4-12(8-15)20-28-29-30-31(20)17-11-35-18-16(10-34-19(17)18)27-21(32)26-14-6-3-5-13(9-14)22(23,24)25/h2-9,16-19H,10-11H2,1H3,(H2,26,27,32) |
| InChIKey | XCEXCKHEADBWHM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |