C23H27N7O5 — CID 11879574
1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4-methoxyphenyl)urea (PubChem CID 11879574) has the molecular formula C23H27N7O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 11879574 |
| Molecular Formula | C23H27N7O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3n2nnnc2Oc2cccc(N(C)C)c2)cc1 |
| InChI | InChI=1S/C23H27N7O5/c1-29(2)15-5-4-6-17(11-15)35-23-26-27-28-30(23)19-13-34-20-18(12-33-21(19)20)25-22(31)24-14-7-9-16(32-3)10-8-14/h4-11,18-21H,12-13H2,1-3H3,(H2,24,25,31)/t18-,19-,20+,21+/m0/s1 |
| InChIKey | KMRVQXYDVBIFFD-UWHLTILDSA-N |
| XLogP | 2.07 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |