C22H22N6O5S — CID 73132292
methyl 3-[[6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate (PubChem CID 73132292) has the molecular formula C22H22N6O5S and a molecular weight of 482.52 g/mol. Its IUPAC name is methyl 3-[[6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 73132292 |
| Molecular Formula | C22H22N6O5S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | methyl 3-[[6-(5-phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NC2COC3C2OCC3n2nnnc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N6O5S/c1-30-20(29)13-6-5-7-14(10-13)23-21(34)24-16-11-31-19-17(12-32-18(16)19)28-22(25-26-27-28)33-15-8-3-2-4-9-15/h2-10,16-19H,11-12H2,1H3,(H2,23,24,34) |
| InChIKey | JIKXMUUBAZMDGP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|