C24H27N7O5S — CID 11879587
methyl 3-[[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate (PubChem CID 11879587) has the molecular formula C24H27N7O5S and a molecular weight of 525.59 g/mol. Its IUPAC name is methyl 3-[[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 11879587 |
| Molecular Formula | C24H27N7O5S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | methyl 3-[[(3S,3aR,6S,6aR)-6-[5-[3-(dimethylamino)phenoxy]tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)N[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3n2nnnc2Oc2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C24H27N7O5S/c1-30(2)16-8-5-9-17(11-16)36-24-27-28-29-31(24)19-13-35-20-18(12-34-21(19)20)26-23(37)25-15-7-4-6-14(10-15)22(32)33-3/h4-11,18-21H,12-13H2,1-3H3,(H2,25,26,37)/t18-,19-,20+,21+/m0/s1 |
| InChIKey | KDGOVCJCKJFQPK-UWHLTILDSA-N |
| XLogP | 2.01 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|