C22H23N3O6S — CID 74685814
methyl 3-[[6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate (PubChem CID 74685814) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is methyl 3-[[6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 74685814 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | methyl 3-[[6-(phenylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NC2COC3C(OC(=O)Nc4ccccc4)COC23)c1 |
| InChI | InChI=1S/C22H23N3O6S/c1-28-20(26)13-6-5-9-15(10-13)23-21(32)25-16-11-29-19-17(12-30-18(16)19)31-22(27)24-14-7-3-2-4-8-14/h2-10,16-19H,11-12H2,1H3,(H,24,27)(H2,23,25,32) |
| InChIKey | RYIUHXHSXGSWKQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|