C18H22N2O7 — CID 11885943
methyl 3-[[(3S,3aR,6R,6aS)-6-(ethylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate (PubChem CID 11885943) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is methyl 3-[[(3S,3aR,6R,6aS)-6-(ethylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate.
| Compound Name | methyl 3-[[(3S,3aR,6R,6aS)-6-(ethylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 11885943 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | methyl 3-[[(3S,3aR,6R,6aS)-6-(ethylcarbamoyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoate |
| SMILES | CCNC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H22N2O7/c1-3-19-18(23)27-13-9-26-14-12(8-25-15(13)14)20-16(21)10-5-4-6-11(7-10)17(22)24-2/h4-7,12-15H,3,8-9H2,1-2H3,(H,19,23)(H,20,21)/t12-,13+,14+,15+/m0/s1 |
| InChIKey | FVDQLCNFSWKIAG-GBJTYRQASA-N |
| XLogP | 0.48 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |