C17H19F3N2O5 — CID 11884115
[(3S,3aR,6R,6aS)-3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate (PubChem CID 11884115) has the molecular formula C17H19F3N2O5 and a molecular weight of 388.34 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 11884115 |
| Molecular Formula | C17H19F3N2O5 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N2O5/c1-2-21-16(24)27-12-8-26-13-11(7-25-14(12)13)22-15(23)9-3-5-10(6-4-9)17(18,19)20/h3-6,11-14H,2,7-8H2,1H3,(H,21,24)(H,22,23)/t11-,12+,13+,14+/m0/s1 |
| InChIKey | QYCHQTFKUAKCDT-REWJHTLYSA-N |
| XLogP | 1.72 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |