C21H25F3N2O5 — CID 73133010
[3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate (PubChem CID 73133010) has the molecular formula C21H25F3N2O5 and a molecular weight of 442.43 g/mol. Its IUPAC name is [3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate.
| Compound Name | [3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 73133010 |
| Molecular Formula | C21H25F3N2O5 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [3-[[4-(trifluoromethyl)benzoyl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC1COC2C(NC(=O)c3ccc(C(F)(F)F)cc3)COC12 |
| InChI | InChI=1S/C21H25F3N2O5/c22-21(23,24)13-8-6-12(7-9-13)19(27)26-15-10-29-18-16(11-30-17(15)18)31-20(28)25-14-4-2-1-3-5-14/h6-9,14-18H,1-5,10-11H2,(H,25,28)(H,26,27) |
| InChIKey | ANOFKSHKDCKQTD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |