C21H28N2O6 — CID 90285975
methyl 4-[[(3S,3aR,6S,6aR)-3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzoate (PubChem CID 90285975) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl 4-[[(3S,3aR,6S,6aR)-3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzoate.
| Compound Name | methyl 4-[[(3S,3aR,6S,6aR)-3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzoate |
|---|---|
| PubChem CID | 90285975 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | methyl 4-[[(3S,3aR,6S,6aR)-3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]benzoate |
| SMILES | COC(=O)c1ccc(O[C@H]2CO[C@H]3[C@H]2OC[C@@H]3NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O6/c1-26-20(24)13-7-9-15(10-8-13)29-17-12-28-18-16(11-27-19(17)18)23-21(25)22-14-5-3-2-4-6-14/h7-10,14,16-19H,2-6,11-12H2,1H3,(H2,22,23,25)/t16-,17-,18+,19-/m0/s1 |
| InChIKey | CJYCFGPMJPMVRM-OKYOBFRVSA-N |
| XLogP | 2.02 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |