C22H32N4O4 — CID 90285444
1-[(3S,3aR,6S,6aS)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea (PubChem CID 90285444) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aS)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3S,3aR,6S,6aS)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 90285444 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[(3S,3aR,6S,6aS)-6-[(6-pyrrolidin-1-yl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2Oc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C22H32N4O4/c27-22(24-15-6-2-1-3-7-15)25-17-13-28-21-18(14-29-20(17)21)30-16-8-9-19(23-12-16)26-10-4-5-11-26/h8-9,12,15,17-18,20-21H,1-7,10-11,13-14H2,(H2,24,25,27)/t17-,18-,20+,21+/m0/s1 |
| InChIKey | NEZARKDQNLOBRP-FMWKFLBASA-N |
| XLogP | 2.23 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |