C24H29N3O5 — CID 126613273
1-[(3S,3aR,6S,6aS)-6-(3-pyridin-2-yloxyphenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea (PubChem CID 126613273) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aS)-6-(3-pyridin-2-yloxyphenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3S,3aR,6S,6aS)-6-(3-pyridin-2-yloxyphenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 126613273 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1-[(3S,3aR,6S,6aS)-6-(3-pyridin-2-yloxyphenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2Oc1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C24H29N3O5/c28-24(26-16-7-2-1-3-8-16)27-19-14-29-23-20(15-30-22(19)23)31-17-9-6-10-18(13-17)32-21-11-4-5-12-25-21/h4-6,9-13,16,19-20,22-23H,1-3,7-8,14-15H2,(H2,26,27,28)/t19-,20-,22+,23+/m0/s1 |
| InChIKey | ZCILTJACDFFZRZ-JFJDKTSWSA-N |
| XLogP | 3.42 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |