C21H31N3O5 — CID 77105108
1-[(3S,3aR,6S,6aS)-6-[[5-(2-hydroxypropan-2-yl)-3-pyridinyl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea (PubChem CID 77105108) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aS)-6-[[5-(2-hydroxypropan-2-yl)-3-pyridinyl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3S,3aR,6S,6aS)-6-[[5-(2-hydroxypropan-2-yl)-3-pyridinyl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 77105108 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[(3S,3aR,6S,6aS)-6-[[5-(2-hydroxypropan-2-yl)-3-pyridinyl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-cyclohexylurea |
| SMILES | CC(C)(O)c1cncc(O[C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C21H31N3O5/c1-21(2,26)13-8-15(10-22-9-13)29-17-12-28-18-16(11-27-19(17)18)24-20(25)23-14-6-4-3-5-7-14/h8-10,14,16-19,26H,3-7,11-12H2,1-2H3,(H2,23,24,25)/t16-,17-,18+,19+/m0/s1 |
| InChIKey | SKIWNKRAOIUHPX-INDMIFKZSA-N |
| XLogP | 1.85 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |