C21H20F3NO4 — CID 11886487
N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide (PubChem CID 11886487) has the molecular formula C21H20F3NO4 and a molecular weight of 407.39 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11886487 |
| Molecular Formula | C21H20F3NO4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F3NO4/c22-21(23,24)15-8-6-14(7-9-15)20(26)25-16-11-28-19-17(12-29-18(16)19)27-10-13-4-2-1-3-5-13/h1-9,16-19H,10-12H2,(H,25,26)/t16-,17+,18+,19+/m0/s1 |
| InChIKey | PDCZGNOEJJKGFL-WJFTUGDTSA-N |
| XLogP | 3.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |