C21H22O6 — CID 58151002
[(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(hydroxymethyl)benzoate (PubChem CID 58151002) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(hydroxymethyl)benzoate.
| Compound Name | [(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 58151002 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-(hydroxymethyl)benzoate |
| SMILES | O=C(O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C21H22O6/c22-10-14-6-8-16(9-7-14)21(23)27-18-13-26-19-17(12-25-20(18)19)24-11-15-4-2-1-3-5-15/h1-9,17-20,22H,10-13H2/t17-,18-,19-,20-/m1/s1 |
| InChIKey | PHXQRRVHIVYOBF-UAFMIMERSA-N |
| XLogP | 2.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |