C27H26O6 — CID 154033714
[(1R,4R,5R,6S,7R)-4,6-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-7-yl] benzoate (PubChem CID 154033714) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(1R,4R,5R,6S,7R)-4,6-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-7-yl] benzoate.
| Compound Name | [(1R,4R,5R,6S,7R)-4,6-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-7-yl] benzoate |
|---|---|
| PubChem CID | 154033714 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [(1R,4R,5R,6S,7R)-4,6-bis(phenylmethoxy)-2,8-dioxabicyclo[3.2.1]octan-7-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@@H]2OC[C@@H](OCc3ccccc3)[C@@H](O2)[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26O6/c28-26(21-14-8-3-9-15-21)32-25-24(30-17-20-12-6-2-7-13-20)23-22(18-31-27(25)33-23)29-16-19-10-4-1-5-11-19/h1-15,22-25,27H,16-18H2/t22-,23-,24+,25-,27-/m1/s1 |
| InChIKey | PBKVLWDPSPGRHS-ZANOAUCBSA-N |
| XLogP | 4.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |