C23H22O8 — CID 100926196
[(1S,5R,6R,7S,8R,9S)-8-acetyloxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate (PubChem CID 100926196) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is [(1S,5R,6R,7S,8R,9S)-8-acetyloxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate.
| Compound Name | [(1S,5R,6R,7S,8R,9S)-8-acetyloxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate |
|---|---|
| PubChem CID | 100926196 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [(1S,5R,6R,7S,8R,9S)-8-acetyloxy-9-phenylmethoxy-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC3O[C@H]([C@H]2OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1O3 |
| InChI | InChI=1S/C23H22O8/c1-13(24)27-19-17-16(26-12-14-8-4-2-5-9-14)18-20(21(19)31-23(29-17)30-18)28-22(25)15-10-6-3-7-11-15/h2-11,16-21,23H,12H2,1H3/t16-,17-,18+,19+,20+,21-,23?/m0/s1 |
| InChIKey | QXLZSVJZUBZORT-DGWXBFFTSA-N |
| XLogP | 2.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |