C22H23BrO6 — CID 101152536
[(2S,3S,4R,5R,6S)-5-acetyloxy-6-bromo-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 101152536) has the molecular formula C22H23BrO6 and a molecular weight of 463.32 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-5-acetyloxy-6-bromo-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5R,6S)-5-acetyloxy-6-bromo-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101152536 |
| Molecular Formula | C22H23BrO6 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-5-acetyloxy-6-bromo-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H](OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](C)O[C@H]1Br |
| InChI | InChI=1S/C22H23BrO6/c1-14-18(29-22(25)17-11-7-4-8-12-17)19(20(21(23)27-14)28-15(2)24)26-13-16-9-5-3-6-10-16/h3-12,14,18-21H,13H2,1-2H3/t14-,18-,19+,20+,21+/m0/s1 |
| InChIKey | JYHBNTFNUFGTDK-UURVTBTISA-N |
| XLogP | 3.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|