C24H28O6S — CID 138981486
[(3R,6S)-4-acetyloxy-6-ethylsulfanyl-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 138981486) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is [(3R,6S)-4-acetyloxy-6-ethylsulfanyl-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(3R,6S)-4-acetyloxy-6-ethylsulfanyl-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 138981486 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [(3R,6S)-4-acetyloxy-6-ethylsulfanyl-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | CCS[C@@H]1OC(C)[C@@H](OC(=O)c2ccccc2)C(OC(C)=O)C1OCc1ccccc1 |
| InChI | InChI=1S/C24H28O6S/c1-4-31-24-22(27-15-18-11-7-5-8-12-18)21(29-17(3)25)20(16(2)28-24)30-23(26)19-13-9-6-10-14-19/h5-14,16,20-22,24H,4,15H2,1-3H3/t16?,20-,21?,22?,24+/m1/s1 |
| InChIKey | NVYYVKASAVUJJV-JRQLHVNPSA-N |
| XLogP | 4.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |