C34H34O5 — CID 102168602
[(2S,6S)-2,4,6-tris(phenylmethoxy)cyclohexyl] benzoate (PubChem CID 102168602) has the molecular formula C34H34O5 and a molecular weight of 522.64 g/mol. Its IUPAC name is [(2S,6S)-2,4,6-tris(phenylmethoxy)cyclohexyl] benzoate.
| Compound Name | [(2S,6S)-2,4,6-tris(phenylmethoxy)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 102168602 |
| Molecular Formula | C34H34O5 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(2S,6S)-2,4,6-tris(phenylmethoxy)cyclohexyl] benzoate |
| SMILES | O=C(OC1[C@@H](OCc2ccccc2)CC(OCc2ccccc2)C[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34O5/c35-34(29-19-11-4-12-20-29)39-33-31(37-24-27-15-7-2-8-16-27)21-30(36-23-26-13-5-1-6-14-26)22-32(33)38-25-28-17-9-3-10-18-28/h1-20,30-33H,21-25H2/t30?,31-,32-,33?/m0/s1 |
| InChIKey | XUCKZFGKRUPWQD-DNDVYCJVSA-N |
| XLogP | 6.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |