C20H21FO4 — CID 10315460
[(2S,3S,5S)-6-fluoro-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 10315460) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is [(2S,3S,5S)-6-fluoro-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,5S)-6-fluoro-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 10315460 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [(2S,3S,5S)-6-fluoro-2-methyl-5-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | C[C@@H]1OC(F)[C@@H](OCc2ccccc2)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21FO4/c1-14-17(25-20(22)16-10-6-3-7-11-16)12-18(19(21)24-14)23-13-15-8-4-2-5-9-15/h2-11,14,17-19H,12-13H2,1H3/t14-,17-,18-,19?/m0/s1 |
| InChIKey | YPBQIOHNLCGLJI-CTQCHYAJSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |