C13H15BrO3 — CID 10756540
[(2R,3S,5R)-5-(bromomethyl)-2-methyloxolan-3-yl] benzoate (PubChem CID 10756540) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(bromomethyl)-2-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-5-(bromomethyl)-2-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 10756540 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | [(2R,3S,5R)-5-(bromomethyl)-2-methyloxolan-3-yl] benzoate |
| SMILES | C[C@H]1O[C@@H](CBr)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15BrO3/c1-9-12(7-11(8-14)16-9)17-13(15)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-,11-,12+/m1/s1 |
| InChIKey | HHRGZSXPJYISAF-JLLWLGSASA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|