C25H28O6 — CID 164829804
[(2S,3R,5R,6R)-5-benzoyloxy-2-methyl-6-pent-4-enoxyoxan-3-yl] benzoate (PubChem CID 164829804) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(2S,3R,5R,6R)-5-benzoyloxy-2-methyl-6-pent-4-enoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,5R,6R)-5-benzoyloxy-2-methyl-6-pent-4-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 164829804 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [(2S,3R,5R,6R)-5-benzoyloxy-2-methyl-6-pent-4-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCCCO[C@@H]1O[C@@H](C)[C@H](OC(=O)c2ccccc2)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28O6/c1-3-4-11-16-28-25-22(31-24(27)20-14-9-6-10-15-20)17-21(18(2)29-25)30-23(26)19-12-7-5-8-13-19/h3,5-10,12-15,18,21-22,25H,1,4,11,16-17H2,2H3/t18-,21+,22+,25+/m0/s1 |
| InChIKey | SIBIZETYKSCQRU-CRJVXGLXSA-N |
| XLogP | 4.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|