C53H70O16 — CID 89059364
[2-[[4-benzoyloxy-5-[(4-benzoyloxy-3-butoxy-5-pent-4-enoxyoxolan-2-yl)methoxy]-3-butoxyoxolan-2-yl]methoxy]-4-butoxy-5-(hydroxymethyl)oxolan-3-yl] benzoate (PubChem CID 89059364) has the molecular formula C53H70O16 and a molecular weight of 963.13 g/mol. Its IUPAC name is [2-[[4-benzoyloxy-5-[(4-benzoyloxy-3-butoxy-5-pent-4-enoxyoxolan-2-yl)methoxy]-3-butoxyoxolan-2-yl]methoxy]-4-butoxy-5-(hydroxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [2-[[4-benzoyloxy-5-[(4-benzoyloxy-3-butoxy-5-pent-4-enoxyoxolan-2-yl)methoxy]-3-butoxyoxolan-2-yl]methoxy]-4-butoxy-5-(hydroxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 89059364 |
| Molecular Formula | C53H70O16 |
| Molecular Weight | 963.13 g/mol |
| Exact Mass | 962.47 |
| IUPAC Name | [2-[[4-benzoyloxy-5-[(4-benzoyloxy-3-butoxy-5-pent-4-enoxyoxolan-2-yl)methoxy]-3-butoxyoxolan-2-yl]methoxy]-4-butoxy-5-(hydroxymethyl)oxolan-3-yl] benzoate |
| SMILES | C=CCCCOC1OC(COC2OC(COC3OC(CO)C(OCCCC)C3OC(=O)c3ccccc3)C(OCCCC)C2OC(=O)c2ccccc2)C(OCCCC)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C53H70O16/c1-5-9-22-32-61-51-46(68-49(56)37-25-18-14-19-26-37)43(59-30-11-7-3)40(65-51)34-63-53-47(69-50(57)38-27-20-15-21-28-38)44(60-31-12-8-4)41(66-53)35-62-52-45(67-48(55)36-23-16-13-17-24-36)42(39(33-54)64-52)58-29-10-6-2/h5,13-21,23-28,39-47,51-54H,1,6-12,22,29-35H2,2-4H3 |
| InChIKey | BCOREGBOQYBOQY-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 182.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.13 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|