C31H41N3O7Si — CID 10698748
[(2R,3S,4R,5R,6R)-5-azido-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-pent-4-enoxyoxan-3-yl] benzoate (PubChem CID 10698748) has the molecular formula C31H41N3O7Si and a molecular weight of 595.77 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-azido-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-pent-4-enoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-azido-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-pent-4-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 10698748 |
| Molecular Formula | C31H41N3O7Si |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-azido-4-benzoyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-pent-4-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCCCO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C31H41N3O7Si/c1-7-8-15-20-37-30-25(33-34-32)27(41-29(36)23-18-13-10-14-19-23)26(40-28(35)22-16-11-9-12-17-22)24(39-30)21-38-42(5,6)31(2,3)4/h7,9-14,16-19,24-27,30H,1,8,15,20-21H2,2-6H3/t24-,25-,26-,27-,30-/m1/s1 |
| InChIKey | IXXIJEIYPZXUGT-ASQLHGERSA-N |
| XLogP | 6.85 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|