C20H32N6O6 — CID 102007728
[(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-dec-9-enoxyoxan-2-yl]methyl acetate (PubChem CID 102007728) has the molecular formula C20H32N6O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-dec-9-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-dec-9-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102007728 |
| Molecular Formula | C20H32N6O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-diazido-6-dec-9-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCCCCCCCCO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H32N6O6/c1-4-5-6-7-8-9-10-11-12-29-20-18(24-26-22)17(23-25-21)19(31-15(3)28)16(32-20)13-30-14(2)27/h4,16-20H,1,5-13H2,2-3H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | ZMIHYUDVUDKZSO-OUUBHVDSSA-N |
| XLogP | 4.50 |
| TPSA | 168.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|