C19H29N3O10 — CID 75983292
methyl 6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxyhexanoate (PubChem CID 75983292) has the molecular formula C19H29N3O10 and a molecular weight of 459.45 g/mol. Its IUPAC name is methyl 6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxyhexanoate.
| Compound Name | methyl 6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 75983292 |
| Molecular Formula | C19H29N3O10 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | methyl 6-[4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C19H29N3O10/c1-11(23)29-10-14-17(30-12(2)24)18(31-13(3)25)16(21-22-20)19(32-14)28-9-7-5-6-8-15(26)27-4/h14,16-19H,5-10H2,1-4H3 |
| InChIKey | YXPSCQHTIYEOJJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 172.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|