C28H36N4O10 — CID 139611922
[(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-[8-(1,3-dioxoisoindol-2-yl)octoxy]oxan-2-yl]methyl acetate (PubChem CID 139611922) has the molecular formula C28H36N4O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-[8-(1,3-dioxoisoindol-2-yl)octoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-[8-(1,3-dioxoisoindol-2-yl)octoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139611922 |
| Molecular Formula | C28H36N4O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4-diacetyloxy-5-azido-6-[8-(1,3-dioxoisoindol-2-yl)octoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCCCCCCCN2C(=O)c3ccccc3C2=O)[C@@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H36N4O10/c1-17(33)39-16-22-24(40-18(2)34)25(41-19(3)35)23(30-31-29)28(42-22)38-15-11-7-5-4-6-10-14-32-26(36)20-12-8-9-13-21(20)27(32)37/h8-9,12-13,22-25,28H,4-7,10-11,14-16H2,1-3H3/t22-,23+,24-,25-,28+/m1/s1 |
| InChIKey | BYKVLKMWWFPSKL-SMOQRCJMSA-N |
| XLogP | 3.47 |
| TPSA | 183.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|