C29H36N2O12 — CID 125320518
[(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[7-(1,3-dioxoisoindol-2-yl)heptanoylamino]oxan-2-yl]methyl acetate (PubChem CID 125320518) has the molecular formula C29H36N2O12 and a molecular weight of 604.61 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[7-(1,3-dioxoisoindol-2-yl)heptanoylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[7-(1,3-dioxoisoindol-2-yl)heptanoylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 125320518 |
| Molecular Formula | C29H36N2O12 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[7-(1,3-dioxoisoindol-2-yl)heptanoylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OC(C)=O)[C@H](NC(=O)CCCCCCN2C(=O)c3ccccc3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H36N2O12/c1-16(32)39-15-22-25(40-17(2)33)26(41-18(3)34)24(29(43-22)42-19(4)35)30-23(36)13-7-5-6-10-14-31-27(37)20-11-8-9-12-21(20)28(31)38/h8-9,11-12,22,24-26,29H,5-7,10,13-15H2,1-4H3,(H,30,36)/t22-,24+,25+,26+,29-/m0/s1 |
| InChIKey | QNUXZEWIJXLGKZ-KNQBOOKYSA-N |
| XLogP | 1.43 |
| TPSA | 180.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|