C52H50N4O15 — CID 91434231
[(3R,4S,5R,6R)-3,4,5-tris[3-(1,3-dioxoisoindol-2-yl)propoxy]-6-[3-(1,3-dioxoisoindol-2-yl)propoxymethyl]oxan-2-yl] acetate (PubChem CID 91434231) has the molecular formula C52H50N4O15 and a molecular weight of 970.98 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-3,4,5-tris[3-(1,3-dioxoisoindol-2-yl)propoxy]-6-[3-(1,3-dioxoisoindol-2-yl)propoxymethyl]oxan-2-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-3,4,5-tris[3-(1,3-dioxoisoindol-2-yl)propoxy]-6-[3-(1,3-dioxoisoindol-2-yl)propoxymethyl]oxan-2-yl] acetate |
|---|---|
| PubChem CID | 91434231 |
| Molecular Formula | C52H50N4O15 |
| Molecular Weight | 970.98 g/mol |
| Exact Mass | 970.33 |
| IUPAC Name | [(3R,4S,5R,6R)-3,4,5-tris[3-(1,3-dioxoisoindol-2-yl)propoxy]-6-[3-(1,3-dioxoisoindol-2-yl)propoxymethyl]oxan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COCCCN2C(=O)c3ccccc3C2=O)[C@@H](OCCCN2C(=O)c3ccccc3C2=O)[C@H](OCCCN2C(=O)c3ccccc3C2=O)[C@H]1OCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C52H50N4O15/c1-31(57)70-52-43(69-29-13-25-56-50(64)38-20-8-9-21-39(38)51(56)65)42(68-28-12-24-55-48(62)36-18-6-7-19-37(36)49(55)63)41(67-27-11-23-54-46(60)34-16-4-5-17-35(34)47(54)61)40(71-52)30-66-26-10-22-53-44(58)32-14-2-3-15-33(32)45(53)59/h2-9,14-21,40-43,52H,10-13,22-30H2,1H3/t40-,41-,42+,43-,52?/m1/s1 |
| InChIKey | SONSEPHBQJUYKZ-PIMKJETISA-N |
| XLogP | 4.19 |
| TPSA | 221.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|