C22H23NO11 — CID 54408560
[(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-[(1,3-dioxoisoindol-2-yl)methyl]oxan-3-yl] acetate (PubChem CID 54408560) has the molecular formula C22H23NO11 and a molecular weight of 477.42 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-[(1,3-dioxoisoindol-2-yl)methyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-[(1,3-dioxoisoindol-2-yl)methyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 54408560 |
| Molecular Formula | C22H23NO11 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | [(2R,3S,4S,5R)-4,5,6-triacetyloxy-2-[(1,3-dioxoisoindol-2-yl)methyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CN2C(=O)c3ccccc3C2=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H23NO11/c1-10(24)30-17-16(9-23-20(28)14-7-5-6-8-15(14)21(23)29)34-22(33-13(4)27)19(32-12(3)26)18(17)31-11(2)25/h5-8,16-19,22H,9H2,1-4H3/t16-,17+,18+,19-,22?/m1/s1 |
| InChIKey | VSMGDPRJOBMUPW-AZTWQAFASA-N |
| XLogP | 0.37 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|