C20H20FNO10 — CID 170261741
[(3S,4R,5R,6S)-4,5-diacetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-3-fluorooxan-2-yl]methyl acetate (PubChem CID 170261741) has the molecular formula C20H20FNO10 and a molecular weight of 453.38 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-4,5-diacetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-3-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R,5R,6S)-4,5-diacetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-3-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170261741 |
| Molecular Formula | C20H20FNO10 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [(3S,4R,5R,6S)-4,5-diacetyloxy-6-(1,3-dioxoisoindol-2-yl)oxy-3-fluorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](ON2C(=O)c3ccccc3C2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1F |
| InChI | InChI=1S/C20H20FNO10/c1-9(23)28-8-14-15(21)16(29-10(2)24)17(30-11(3)25)20(31-14)32-22-18(26)12-6-4-5-7-13(12)19(22)27/h4-7,14-17,20H,8H2,1-3H3/t14?,15-,16-,17+,20-/m0/s1 |
| InChIKey | VGTSIWNUXDPXNP-SUBGPWMZSA-N |
| XLogP | 0.70 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|