C23H26O7 — CID 134882849
[(2R,3R,4R,5S)-5-acetyloxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate (PubChem CID 134882849) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-acetyloxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-5-acetyloxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134882849 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(2R,3R,4R,5S)-5-acetyloxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H26O7/c1-16(24)26-15-20-21(27-13-18-9-5-3-6-10-18)22(23(30-20)29-17(2)25)28-14-19-11-7-4-8-12-19/h3-12,20-23H,13-15H2,1-2H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | UPAWYVMDTSOPFF-SSGKUCQKSA-N |
| XLogP | 3.01 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |