C26H30O7 — CID 86715435
[(2R,3S,4S,5S,6R)-6-acetyloxy-4-ethenyl-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 86715435) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-6-acetyloxy-4-ethenyl-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-6-acetyloxy-4-ethenyl-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86715435 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-6-acetyloxy-4-ethenyl-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | C=C[C@@H]1[C@H](OCc2ccccc2)[C@@H](OC(C)=O)O[C@H](COC(C)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H30O7/c1-4-22-24(30-15-20-11-7-5-8-12-20)23(17-29-18(2)27)33-26(32-19(3)28)25(22)31-16-21-13-9-6-10-14-21/h4-14,22-26H,1,15-17H2,2-3H3/t22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | RRBOWQVFPZUASL-UUNMLIRYSA-N |
| XLogP | 3.81 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|