C15H27FO5 — CID 90339252
[(2S,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl] acetate (PubChem CID 90339252) has the molecular formula C15H27FO5 and a molecular weight of 306.37 g/mol. Its IUPAC name is [(2S,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl] acetate.
| Compound Name | [(2S,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl] acetate |
|---|---|
| PubChem CID | 90339252 |
| Molecular Formula | C15H27FO5 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [(2S,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl] acetate |
| SMILES | CCCCOC[C@H]1O[C@@H](OC(C)=O)[C@@H](F)C1OCCCC |
| InChI | InChI=1S/C15H27FO5/c1-4-6-8-18-10-12-14(19-9-7-5-2)13(16)15(21-12)20-11(3)17/h12-15H,4-10H2,1-3H3/t12-,13+,14?,15-/m1/s1 |
| InChIKey | CSNQPNPPUQWWBS-IZGVIRRGSA-N |
| XLogP | 2.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|