C17H32O6 — CID 100927783
[(2R,3R,4R,5S)-4-butoxy-2-(butoxymethyl)-5-methoxyoxan-3-yl] acetate (PubChem CID 100927783) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-butoxy-2-(butoxymethyl)-5-methoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-4-butoxy-2-(butoxymethyl)-5-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 100927783 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | [(2R,3R,4R,5S)-4-butoxy-2-(butoxymethyl)-5-methoxyoxan-3-yl] acetate |
| SMILES | CCCCOC[C@H]1OCC(OC)[C@@H](OCCCC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H32O6/c1-5-7-9-20-11-15-17(23-13(3)18)16(21-10-8-6-2)14(19-4)12-22-15/h14-17H,5-12H2,1-4H3/t14?,15-,16-,17-/m1/s1 |
| InChIKey | YPUGBAYFHVFKFQ-XMMHPARDSA-N |
| XLogP | 2.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|