C19H36O5S — CID 118336664
[(2R,3R,4S,5R)-3,4-dibutoxy-5-(butoxymethyl)thiolan-2-yl] acetate (PubChem CID 118336664) has the molecular formula C19H36O5S and a molecular weight of 376.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-dibutoxy-5-(butoxymethyl)thiolan-2-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-dibutoxy-5-(butoxymethyl)thiolan-2-yl] acetate |
|---|---|
| PubChem CID | 118336664 |
| Molecular Formula | C19H36O5S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-dibutoxy-5-(butoxymethyl)thiolan-2-yl] acetate |
| SMILES | CCCCOC[C@H]1S[C@@H](OC(C)=O)[C@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C19H36O5S/c1-5-8-11-21-14-16-17(22-12-9-6-2)18(23-13-10-7-3)19(25-16)24-15(4)20/h16-19H,5-14H2,1-4H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | YJDKBWQPULVIQJ-NCXUSEDFSA-N |
| XLogP | 4.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|