C13H24O6 — CID 90360142
[(2R,3S,5R)-5-butoxy-4-hydroxy-2-methoxy-6-methyloxan-3-yl] acetate (PubChem CID 90360142) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(2R,3S,5R)-5-butoxy-4-hydroxy-2-methoxy-6-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-5-butoxy-4-hydroxy-2-methoxy-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 90360142 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [(2R,3S,5R)-5-butoxy-4-hydroxy-2-methoxy-6-methyloxan-3-yl] acetate |
| SMILES | CCCCO[C@H]1C(C)O[C@@H](OC)[C@@H](OC(C)=O)C1O |
| InChI | InChI=1S/C13H24O6/c1-5-6-7-17-11-8(2)18-13(16-4)12(10(11)15)19-9(3)14/h8,10-13,15H,5-7H2,1-4H3/t8?,10?,11-,12-,13+/m0/s1 |
| InChIKey | LBKLPFLSGXDWHE-RWBZJECHSA-N |
| XLogP | 0.86 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|