C22H44O6 — CID 70406349
(1S,2R,3R,4S,5S,6R)-3,4,5,6-tetrabutoxycyclohexane-1,2-diol (PubChem CID 70406349) has the molecular formula C22H44O6 and a molecular weight of 404.59 g/mol. Its IUPAC name is (1S,2R,3R,4S,5S,6R)-3,4,5,6-tetrabutoxycyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,5S,6R)-3,4,5,6-tetrabutoxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 70406349 |
| Molecular Formula | C22H44O6 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (1S,2R,3R,4S,5S,6R)-3,4,5,6-tetrabutoxycyclohexane-1,2-diol |
| SMILES | CCCCOC1[C@@H](O)[C@@H](O)[C@@H](OCCCC)[C@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C22H44O6/c1-5-9-13-25-19-17(23)18(24)20(26-14-10-6-2)22(28-16-12-8-4)21(19)27-15-11-7-3/h17-24H,5-16H2,1-4H3/t17-,18+,19-,20?,21+,22+/m1/s1 |
| InChIKey | OYQDBTHEXLLNGN-XIFZDOJDSA-N |
| XLogP | 3.46 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|