C14H32O18P4 — CID 18394293
[(1S,2R,3S,4S,5R,6R)-2,3-dibutoxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 18394293) has the molecular formula C14H32O18P4 and a molecular weight of 612.29 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R,6R)-2,3-dibutoxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1S,2R,3S,4S,5R,6R)-2,3-dibutoxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18394293 |
| Molecular Formula | C14H32O18P4 |
| Molecular Weight | 612.29 g/mol |
| Exact Mass | 612.05 |
| IUPAC Name | [(1S,2R,3S,4S,5R,6R)-2,3-dibutoxy-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | CCCCO[C@@H]1[C@H](OCCCC)[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@H]1OP(=O)(O)O |
| InChI | InChI=1S/C14H32O18P4/c1-3-5-7-27-9-10(28-8-6-4-2)12(30-34(18,19)20)14(32-36(24,25)26)13(31-35(21,22)23)11(9)29-33(15,16)17/h9-14H,3-8H2,1-2H3,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)/t9-,10+,11-,12-,13+,14+/m0/s1 |
| InChIKey | XLOOPBUMALPFAF-XNBXPENISA-N |
| XLogP | 0.28 |
| TPSA | 285.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.29 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|