C24H45O18P3 — CID 87475014
2-[hydroxy-[(1S,2R,4S,5S)-2,3,4-tributoxy-5,6-bis[[carboxymethyl(hydroxy)phosphoryl]oxy]cyclohexyl]oxyphosphoryl]acetic acid (PubChem CID 87475014) has the molecular formula C24H45O18P3 and a molecular weight of 714.53 g/mol. Its IUPAC name is 2-[hydroxy-[(1S,2R,4S,5S)-2,3,4-tributoxy-5,6-bis[[carboxymethyl(hydroxy)phosphoryl]oxy]cyclohexyl]oxyphosphoryl]acetic acid.
| Compound Name | 2-[hydroxy-[(1S,2R,4S,5S)-2,3,4-tributoxy-5,6-bis[[carboxymethyl(hydroxy)phosphoryl]oxy]cyclohexyl]oxyphosphoryl]acetic acid |
|---|---|
| PubChem CID | 87475014 |
| Molecular Formula | C24H45O18P3 |
| Molecular Weight | 714.53 g/mol |
| Exact Mass | 714.18 |
| IUPAC Name | 2-[hydroxy-[(1S,2R,4S,5S)-2,3,4-tributoxy-5,6-bis[[carboxymethyl(hydroxy)phosphoryl]oxy]cyclohexyl]oxyphosphoryl]acetic acid |
| SMILES | CCCCOC1C(OCCCC)[C@@H](OCCCC)[C@H](OP(=O)(O)CC(=O)O)C(OP(=O)(O)CC(=O)O)[C@H]1OP(=O)(O)CC(=O)O |
| InChI | InChI=1S/C24H45O18P3/c1-4-7-10-37-19-20(38-11-8-5-2)22(40-43(31,32)13-16(25)26)24(42-45(35,36)15-18(29)30)23(21(19)39-12-9-6-3)41-44(33,34)14-17(27)28/h19-24H,4-15H2,1-3H3,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36)/t19?,20-,21?,22+,23+,24?/m1/s1 |
| InChIKey | FABRBYGGVXJGNM-AKSICLQRSA-N |
| XLogP | 2.52 |
| TPSA | 279.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|