C27H57O15P3 — CID 87476517
hydroxymethyl-[(1S,2R,4S,5R)-2,3,4-trihexoxy-5,6-bis[[hydroxy(hydroxymethyl)phosphoryl]oxy]cyclohexyl]oxyphosphinic acid (PubChem CID 87476517) has the molecular formula C27H57O15P3 and a molecular weight of 714.66 g/mol. Its IUPAC name is hydroxymethyl-[(1S,2R,4S,5R)-2,3,4-trihexoxy-5,6-bis[[hydroxy(hydroxymethyl)phosphoryl]oxy]cyclohexyl]oxyphosphinic acid.
| Compound Name | hydroxymethyl-[(1S,2R,4S,5R)-2,3,4-trihexoxy-5,6-bis[[hydroxy(hydroxymethyl)phosphoryl]oxy]cyclohexyl]oxyphosphinic acid |
|---|---|
| PubChem CID | 87476517 |
| Molecular Formula | C27H57O15P3 |
| Molecular Weight | 714.66 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | hydroxymethyl-[(1S,2R,4S,5R)-2,3,4-trihexoxy-5,6-bis[[hydroxy(hydroxymethyl)phosphoryl]oxy]cyclohexyl]oxyphosphinic acid |
| SMILES | CCCCCCOC1C(OCCCCCC)[C@@H](OCCCCCC)[C@H](OP(=O)(O)CO)C(OP(=O)(O)CO)[C@@H]1OP(=O)(O)CO |
| InChI | InChI=1S/C27H57O15P3/c1-4-7-10-13-16-37-22-23(38-17-14-11-8-5-2)25(40-43(31,32)19-28)27(42-45(35,36)21-30)26(41-44(33,34)20-29)24(22)39-18-15-12-9-6-3/h22-30H,4-21H2,1-3H3,(H,31,32)(H,33,34)(H,35,36)/t22?,23-,24?,25+,26-,27?/m1/s1 |
| InChIKey | GFYWTHUTDLYXPU-CYSSYTLGSA-N |
| XLogP | 4.46 |
| TPSA | 227.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|