C18H33O18P3 — CID 87872743
[(1S,2R,3R,4R,5S,6R)-2,5-di(butanoyloxy)-3,4,6-triphosphonooxycyclohexyl] butanoate (PubChem CID 87872743) has the molecular formula C18H33O18P3 and a molecular weight of 630.37 g/mol. Its IUPAC name is [(1S,2R,3R,4R,5S,6R)-2,5-di(butanoyloxy)-3,4,6-triphosphonooxycyclohexyl] butanoate.
| Compound Name | [(1S,2R,3R,4R,5S,6R)-2,5-di(butanoyloxy)-3,4,6-triphosphonooxycyclohexyl] butanoate |
|---|---|
| PubChem CID | 87872743 |
| Molecular Formula | C18H33O18P3 |
| Molecular Weight | 630.37 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | [(1S,2R,3R,4R,5S,6R)-2,5-di(butanoyloxy)-3,4,6-triphosphonooxycyclohexyl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@H](OC(=O)CCC)[C@@H](OP(=O)(O)O)[C@H](OC(=O)CCC)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C18H33O18P3/c1-4-7-10(19)31-13-14(32-11(20)8-5-2)17(35-38(25,26)27)18(36-39(28,29)30)15(33-12(21)9-6-3)16(13)34-37(22,23)24/h13-18H,4-9H2,1-3H3,(H2,22,23,24)(H2,25,26,27)(H2,28,29,30)/t13-,14+,15-,16+,17+,18+/m0/s1 |
| InChIKey | WGHZEUIDTTWASG-FQESAXDCSA-N |
| XLogP | 0.57 |
| TPSA | 279.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|