C36H57O30P3 — CID 87739999
[(1R,2S,3R,4S,5S,6S)-2,4,5-tris[bis(acetyloxymethoxy)phosphoryloxy]-3,6-di(butanoyloxy)cyclohexyl] butanoate (PubChem CID 87739999) has the molecular formula C36H57O30P3 and a molecular weight of 1062.74 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5S,6S)-2,4,5-tris[bis(acetyloxymethoxy)phosphoryloxy]-3,6-di(butanoyloxy)cyclohexyl] butanoate.
| Compound Name | [(1R,2S,3R,4S,5S,6S)-2,4,5-tris[bis(acetyloxymethoxy)phosphoryloxy]-3,6-di(butanoyloxy)cyclohexyl] butanoate |
|---|---|
| PubChem CID | 87739999 |
| Molecular Formula | C36H57O30P3 |
| Molecular Weight | 1062.74 g/mol |
| Exact Mass | 1062.21 |
| IUPAC Name | [(1R,2S,3R,4S,5S,6S)-2,4,5-tris[bis(acetyloxymethoxy)phosphoryloxy]-3,6-di(butanoyloxy)cyclohexyl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1[C@H](OC(=O)CCC)[C@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@@H](OP(=O)(OCOC(C)=O)OCOC(C)=O)[C@H](OC(=O)CCC)[C@H]1OP(=O)(OCOC(C)=O)OCOC(C)=O |
| InChI | InChI=1S/C36H57O30P3/c1-10-13-28(43)61-31-32(62-29(44)14-11-2)35(65-68(47,57-18-51-24(6)39)58-19-52-25(7)40)36(66-69(48,59-20-53-26(8)41)60-21-54-27(9)42)33(63-30(45)15-12-3)34(31)64-67(46,55-16-49-22(4)37)56-17-50-23(5)38/h31-36H,10-21H2,1-9H3/t31-,32+,33-,34+,35+,36+/m1/s1 |
| InChIKey | GJTDEMVNNQNVCM-ZOXPVIOBSA-N |
| XLogP | 3.84 |
| TPSA | 370.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 30 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 30 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|