C43H69O42P5 — CID 87946498
[2,2,3,4,4-pentakis[bis(acetyloxymethoxy)phosphoryloxy]-3-propylcyclohexyl] butanoate (PubChem CID 87946498) has the molecular formula C43H69O42P5 and a molecular weight of 1412.85 g/mol. Its IUPAC name is [2,2,3,4,4-pentakis[bis(acetyloxymethoxy)phosphoryloxy]-3-propylcyclohexyl] butanoate.
| Compound Name | [2,2,3,4,4-pentakis[bis(acetyloxymethoxy)phosphoryloxy]-3-propylcyclohexyl] butanoate |
|---|---|
| PubChem CID | 87946498 |
| Molecular Formula | C43H69O42P5 |
| Molecular Weight | 1412.85 g/mol |
| Exact Mass | 1412.20 |
| IUPAC Name | [2,2,3,4,4-pentakis[bis(acetyloxymethoxy)phosphoryloxy]-3-propylcyclohexyl] butanoate |
| SMILES | CCCC(=O)OC1CCC(OP(=O)(OCOC(C)=O)OCOC(C)=O)(OP(=O)(OCOC(C)=O)OCOC(C)=O)C(CCC)(OP(=O)(OCOC(C)=O)OCOC(C)=O)C1(OP(=O)(OCOC(C)=O)OCOC(C)=O)OP(=O)(OCOC(C)=O)OCOC(C)=O |
| InChI | InChI=1S/C43H69O42P5/c1-13-15-40(54)80-39-16-18-42(82-87(56,72-21-62-31(5)46)73-22-63-32(6)47,83-88(57,74-23-64-33(7)48)75-24-65-34(8)49)41(17-14-2,81-86(55,70-19-60-29(3)44)71-20-61-30(4)45)43(39,84-89(58,76-25-66-35(9)50)77-26-67-36(10)51)85-90(59,78-27-68-37(11)52)79-28-69-38(12)53/h39H,13-28H2,1-12H3 |
| InChIKey | RNJIWGZYGPNBKB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 513.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 42 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 90 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1412.85 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 42 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|