C16H28O2 — CID 18604130
[(4aR,8aS)-5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl] butanoate (PubChem CID 18604130) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is [(4aR,8aS)-5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl] butanoate.
| Compound Name | [(4aR,8aS)-5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl] butanoate |
|---|---|
| PubChem CID | 18604130 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | [(4aR,8aS)-5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl] butanoate |
| SMILES | CCCC(=O)OC1CCC[C@@H]2[C@@H]1CCCC2(C)C |
| InChI | InChI=1S/C16H28O2/c1-4-7-15(17)18-14-10-5-9-13-12(14)8-6-11-16(13,2)3/h12-14H,4-11H2,1-3H3/t12-,13+,14?/m0/s1 |
| InChIKey | HRFKIRJHQLVCOT-WLDKUNSKSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |