C13H24O — CID 57356126
(5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methanol (PubChem CID 57356126) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methanol.
| Compound Name | (5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 57356126 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (5,5-dimethyl-2,3,4,4a,6,7,8,8a-octahydro-1H-naphthalen-1-yl)methanol |
| SMILES | CC1(C)CCCC2C(CO)CCCC21 |
| InChI | InChI=1S/C13H24O/c1-13(2)8-4-6-11-10(9-14)5-3-7-12(11)13/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | LDUMTGZRDPRBJX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |